ម្សៅ Urolithin B

ខែវិច្ឆិកា 9, 2020

Cofttek គឺជាក្រុមហ៊ុនផលិតម្សៅ Urolithin B ល្អបំផុតនៅក្នុងប្រទេសចិន។ រោងចក្ររបស់យើងមានប្រព័ន្ធគ្រប់គ្រងផលិតកម្មពេញលេញ (អាយអេសអូ ៩០០១ និងអាយអេសអូ ១៤០០១) ដែលមានសមត្ថភាពផលិតប្រចាំខែ ២០០ គីឡូក្រាម។


ស្ថានភាព: នៅក្នុងផលិតកម្មអភិបូជា
អង្គភាព: ១ គីឡូក្រាម / កាបូប ២៥ គ។ ក្រ / ស្គរ


ឈ្មោះ: យូរ៉ូទីលីនខ
ឈ្មោះគីមី: ៣- អ៊ីដ្រូអុកស៊ីដ -៦H-dibenzo [ខ, ឃ] pyran-៦- មួយ
CAS: 1139-83-9.
រូបមន្តគីមី៖ C13H8O3
ទម្ងន់​ម៉ូលេគុល: 212.2 g / mol
color:  ម្សៅស
លេខកូដ SMILES៖ O=C1C2=CC=CC=C2C3=CC=C(O)C=C3O1
អនុគមន៍: Urolithin B អាចធ្វើអោយប្រសើរឡើងនូវមុខងារ mitochondrial និងសាច់ដុំ។

Urolithin B អាចធ្វើអោយប្រសើរឡើងនូវកម្លាំងសាច់ដុំនិងការស៊ូទ្រាំក្នុងវ័យចំណាស់។

កម្មវិធី: Urolithin B គឺជាសារធាតុរំលាយអាហារអតិសុខុមប្រាណនៅក្នុងពោះវៀននិងបង្ហាញនូវសកម្មភាពប្រឆាំងនឹងប្រតិកម្មអុកស៊ីតនិងប្រឆាំងអុកស៊ីតកម្មដ៏ខ្លាំងក្លាអាស្រ័យលើប្រព័ន្ធនិងលក្ខខណ្ឌ។ Urolithin B ក៏អាចបង្ហាញពីអរម៉ូនអ៊ឹស្ត្រូសែននិង / ឬសកម្មភាពប្រឆាំងនឹងអរម៉ូនអ៊ឹស្ត្រូសែន។
ភាពរលាយ: រលាយបានយ៉ាងងាយស្រួលនៅក្នុង N, N-dimethylformamide និង dimethylmethylene ។ ស៊ុលផូណុនរលាយបន្តិចក្នុងមេតាណុលអេតាណុលនិងអេទីលអេទីល
ឧបករណ៍ផ្ទុកទិន្នន័យ: Hygroscopic, -20 ° C ត្រជាក់, នៅក្រោមបរិយាកាស inert
លក្ខខណ្ឌដឹកជញ្ជូន៖ ដឹកតាមសីតុណ្ហភាពព័ទ្ធជុំវិញជាសារធាតុគីមីដែលមិនបង្កគ្រោះថ្នាក់។ ផលិតផលនេះមានស្ថេរភាពគ្រប់គ្រាន់សម្រាប់ពីរបីសប្តាហ៍ក្នុងកំឡុងពេលដឹកជញ្ជូនធម្មតានិងពេលវេលាដែលបានចំណាយនៅក្នុងគយ។


យូរ៉ូទីលីនខ អិនអឹមអេសស្ត្រូរ៉េម

យូរ៉ូទីលីន B (១១៣៩-៨៣-៩) - អិម។ អេស។ អិម។ ស


ប្រសិនបើអ្នកត្រូវការ COA, MSDS, HNMR សម្រាប់ផលិតផលនីមួយៗនិងព័ត៌មានផ្សេងៗសូមទាក់ទងមកយើងខ្ញុំ អ្នកគ្រប់គ្រង​ផ្នែក​ទីផ្សារ.



Urolithins គឺជាសារធាតុរំលាយអាហារបន្ទាប់បន្សំនៃអាស៊ីត ellagic ដែលបានមកពី ellagitannins ។ នៅក្នុងខ្លួនមនុស្ស ellagitannins ត្រូវបានបំប្លែងដោយ microflora ពោះវៀនទៅជាអាស៊ីត ellagic ដែលត្រូវបានផ្លាស់ប្តូរទៅជា urolithins A, urolithin B, urolithin C និង urolithin D នៅក្នុងពោះវៀនធំ។

Urolithin A (UA) គឺជាសារធាតុរំលាយអាហារទូទៅបំផុតនៃ ellagitannins ។ ទោះយ៉ាងណាថ្នាំ urolithin A មិនត្រូវបានគេដឹងថាកើតឡើងដោយធម្មជាតិនៅក្នុងប្រភពនៃរបបអាហារណាមួយឡើយ។

Urolithin B (UB) គឺជាសារធាតុរំលាយអាហារមានច្រើនក្រៃលែងដែលផលិតនៅក្នុងពោះវៀនតាមរយៈការផ្លាស់ប្តូរ ellagitannins ។ Urolithin B គឺជាផលិតផលចុងក្រោយបន្ទាប់ពីគ្រប់ដេរីវេអ៊ុយរ៉ាលីទីនដទៃទៀតត្រូវបានបង្កើតឡើងដោយជាតិគីមី។ Urolithin B ត្រូវបានគេរកឃើញនៅក្នុងទឹកនោមដែលជា urolithin B glucuronide ។

Urolithin A 8-Methyl Ether គឺជាផលិតផលកម្រិតមធ្យមក្នុងកំឡុងពេលសំយោគ Urolithin A. វាជាសារធាតុរំលាយអាហារបន្ទាប់បន្សំដ៏សំខាន់នៃ ellagitannin និងមានសារធាតុប្រឆាំងអុកស៊ីតកម្មនិងប្រឆាំងនឹងការរលាក។


យន្តការនៃសកម្មភាពរបស់ urolithin A និង B

rol អ៊ុយរ៉ូទីន A បណ្តាលអោយមានបញ្ហាបំពង់រំលាយអាហារ

មីតូទីជីគឺជាទម្រង់មួយនៃអូតូអ៊ុយហ្គីដែលជួយលុបបំបាត់មីតូតូនិចដែលខូចសម្រាប់ដំណើរការល្អបំផុតរបស់ពួកគេ។ Autophagy សំដៅទៅលើដំណើរការទូទៅដែលខ្លឹមសារស៊ីតូទីកត្រូវបានបំផ្លាញហើយជាហេតុធ្វើឱ្យកែច្នៃឡើងវិញខណៈពេលដែលបំពង់រំលាយអាហារគឺជាការរិចរិលនិងការកែច្នៃឡើងវិញរបស់មីតូឈីនៀ។

អំឡុងពេលវ័យចំណាស់ការថយចុះនៃជំងឺអូតូអ៊ុយមីនគឺជាទិដ្ឋភាពមួយដែលនាំឱ្យមានការថយចុះមុខងារតូតូទីន។ លើសពីនេះទៀតភាពតានតឹងក្នុងអុកស៊ីតកម្មក៏អាចបណ្តាលឱ្យមានជំងឺអូតូអ៊ុយមីនទាប។ Urolithin A មានសមត្ថភាពក្នុងការលុបបំបាត់ mitochondria ដែលខូចខាតតាមរយៈអូតូអ៊ុយមីន។

properties លក្ខណៈសម្បត្តិប្រឆាំងអុកស៊ីតកម្ម

ភាពតានតឹងអុកស៊ីតកម្មកើតឡើងនៅពេលមានអតុល្យភាពរវាងរ៉ាឌីកាល់សេរីនិងអង់ទីអុកស៊ីដង់នៅក្នុងខ្លួន។ រ៉ាឌីកាល់សេរីលើសទាំងនេះច្រើនតែទាក់ទងនឹងជំងឺរ៉ាំរ៉ៃជាច្រើនដូចជាជំងឺបេះដូងទឹកនោមផ្អែមនិងមហារីក។

Urolithins A និង B បង្ហាញពីឥទ្ធិពលប្រឆាំងអុកស៊ីតកម្មតាមរយៈសមត្ថភាពរបស់ពួកគេក្នុងការកាត់បន្ថយរ៉ាឌីកាល់សេរីនិងជាពិសេសកម្រិតអុកស៊ីសែនប្រតិកម្ម (ROS) និងរារាំងការរំលាយជាតិខ្លាញ់ក្នុងប្រូតេអ៊ីនក្នុងប្រភេទកោសិកាមួយចំនួន។

លើសពីនេះទៀត urolithins អាចទប់ស្កាត់អង់ហ្ស៊ីមអុកស៊ីតកម្មមួយចំនួនរួមមានម៉ុនម៉ីនអុកស៊ីតូស៊ី A និង tyrosinase ។

properties លក្ខណៈសម្បត្តិប្រឆាំងនឹងការរលាក

ការរលាកគឺជាដំណើរការធម្មជាតិមួយដែលរាងកាយរបស់យើងប្រយុទ្ធប្រឆាំងនឹងវត្ថុដែលដួលរលំដូចជាការបង្ករោគការរងរបួសនិងអតិសុខុមប្រាណ។ ទោះជាយ៉ាងណាក៏ដោយការរលាករ៉ាំរ៉ៃអាចបង្កគ្រោះថ្នាក់ដល់រាងកាយដោយសារបញ្ហានេះត្រូវបានផ្សារភ្ជាប់ជាមួយនឹងជំងឺផ្សេងៗដូចជាជំងឺហឺតបញ្ហាបេះដូងនិងជំងឺមហារីក។ ការរលាករ៉ាំរ៉ៃអាចកើតឡើងដោយសារតែការរលាកស្រួចស្រាវដែលមិនត្រូវបានព្យាបាលការឆ្លងមេរោគឬសូម្បីតែរ៉ាឌីកាល់សេរីនៅក្នុងខ្លួន។

Urolithins A និង B បង្ហាញពីលក្ខណៈសម្បត្តិប្រឆាំងនឹងការរលាកដោយរារាំងការផលិតនីត្រាតអុកស៊ីត។ ពួកគេរារាំងជាពិសេសការបញ្ចេញប្រូតេអ៊ីននីត្រាតអុកស៊ីតអុកស៊ីត (iNOS) និងកន្សោម mRNA ដែលទទួលខុសត្រូវចំពោះការរលាក។

effects ផលប៉ះពាល់ប្រឆាំងនឹងអតិសុខុមប្រាណ

អតិសុខុមប្រាណរួមមានបាក់តេរីផ្សិតនិងវីរុសកើតឡើងដោយធម្មជាតិនៅក្នុងបរិស្ថាននិងក្នុងខ្លួនមនុស្ស។ ទោះយ៉ាងណាក៏ដោយអតិសុខុមប្រាណមួយចំនួនដែលសំដៅទៅលើភ្នាក់ងារបង្កជំងឺអាចបង្កឱ្យមានជំងឺឆ្លងដូចជាជំងឺផ្តាសាយកញ្ជ្រិលនិងជំងឺគ្រុនចាញ់។

Urolithin A និង B អាចបង្ហាញសកម្មភាពអង់ទីអុកស៊ីដ្យូមដោយរារាំងការចាប់អារម្មណ៍របស់កូរ៉ុម។ ការដឹងអំពីកូរ៉ុមគឺជារបៀបមួយនៃការប្រាស្រ័យទាក់ទងបាក់តេរីដែលជួយឱ្យបាក់តេរីអាចរកឃើញនិងគ្រប់គ្រងដំណើរការដែលទាក់ទងនឹងការឆ្លងដូចជាភាពរហ័សរហួននិងចលនា។


គ្លីលីកសំដៅទៅលើការភ្ជាប់ជាតិស្ករដែលមិនមានអង់ស៊ីមទៅនឹងជាតិខ្លាញ់ឬប្រូតេអ៊ីន។ វាគឺជាជីវម៉ាសសំខាន់នៅក្នុងជំងឺទឹកនោមផ្អែមនិងជំងឺផ្សេងៗទៀតក៏ដូចជាភាពចាស់។

glycation ប្រូតេអ៊ីនខ្ពស់គឺជាឥទ្ធិពលបន្ទាប់បន្សំនៃ hyperglycemia មានតួនាទីសំខាន់ក្នុងជំងឺដែលទាក់ទងនឹងសរសៃឈាមបេះដូងដូចជាជំងឺទឹកនោមផ្អែមនិងជំងឺវង្វេងវង្វាន់។

Urolithin A និង B មានផ្ទុកនូវសារធាតុប្រឆាំងនឹងរោគ glycative ដែលអាស្រ័យទៅលើកំរិតដែលឯករាជ្យនៃសកម្មភាពប្រឆាំងអុកស៊ីតកម្មរបស់ពួកគេ។


អត្ថប្រយោជន័ Urolithin B

ថ្នាំបំប៉ន Urolithin B ក៏មានគុណប្រយោជន៍ជាច្រើនចំពោះសុខភាពផងដែរហើយភាគច្រើនស្រដៀងទៅនឹងអត្ថប្រយោជន៍របស់ urolithin A ។

(១) សក្តានុពលប្រឆាំងមហារីក
លក្ខណៈសម្បត្តិប្រឆាំងនឹងការរលាករបស់យូរ៉ូទីន B ធ្វើឱ្យវាក្លាយជាបេក្ខជនដ៏ល្អសម្រាប់ប្រយុទ្ធប្រឆាំងនឹងជំងឺមហារីក។ អ្នកស្រាវជ្រាវខ្លះបានរាយការណ៍ពីសក្តានុពលទាំងនេះនៅក្នុងកោសិកាសរសៃខួរក្បាលមីក្រូនិងផ្នែកខាងកោសិកា។

ការសិក្សាបានរាយការណ៍ថា UB ទប់ស្កាត់ជំងឺមហារីកផ្សេងៗគ្នាដូចជាមហារីកក្រពេញប្រូស្តាតមហារីកពោះវៀនធំនិងប្លោកនោម។

នៅក្នុងការសិក្សាដែលពាក់ព័ន្ធនឹងកោសិកាមហារីកពោះវៀនធំរបស់មនុស្ស, អេលីហ្កានិកនីនអាស៊ីតអេលីហ្គិកនិងយូរ៉ូទីន A និង B ត្រូវបានគេវាយតម្លៃចំពោះសក្តានុពលប្រឆាំងនឹងជំងឺមហារីករបស់ពួកគេ។ ពួកគេបានរាយការណ៍ថាការព្យាបាលទាំងអស់អាចរារាំងការលូតលាស់កោសិកាមហារីក។ ពួកគេបានរារាំងការរីកសាយកោសិកាមហារីកតាមរយៈការចាប់ខ្លួនវដ្តកោសិកាក្នុងដំណាក់កាលផ្សេងៗគ្នានិងដោយការជម្រុញ ឲ្យ មានជំងឺ apoptosis ។

(២) អាចជួយប្រឆាំងនឹងស្ត្រេសអុកស៊ីតកម្ម
Urolithin B មានផ្ទុកសារធាតុប្រឆាំងអុកស៊ីតកម្មដ៏ល្អបំផុតតាមរយៈការកាត់បន្ថយកម្រិតប្រភេទអុកស៊ីសែនដែលមានប្រតិកម្មនិងការបន្សាបជាតិខ្លាញ់នៅក្នុងប្រភេទកោសិកាជាក់លាក់។ កម្រិតខ្ពស់នៃ ROS ត្រូវបានផ្សារភ្ជាប់ជាមួយនឹងជំងឺជាច្រើនដូចជាជំងឺអាល់ហ្សៃមឺរ។

នៅក្នុងការសិក្សាដែលមានកោសិកាណឺរ៉ូនប្រឈមនឹងស្ត្រេសអុកស៊ីតកម្មថ្នាំបំប៉ន urolithin B ក៏ដូចជា urolithin A ត្រូវបានគេរកឃើញថាអាចការពារកោសិកាប្រឆាំងនឹងការកត់សុីដូច្នេះបង្កើនការរស់រានរបស់កោសិកា។

(៣) Urolithin B ក្នុងការបង្កើនការចងចាំ
Urolithin b ត្រូវបានគេរាយការណ៍ថាធ្វើឱ្យប្រសើរឡើងនូវភាពធន់នឹងរបាំងឈាម។ នេះជួយបង្កើនមុខងារការយល់ដឹង។

ការសិក្សាបានបង្ហាញថា urolithin B អាចជាអ្នកបង្កើនការចងចាំដ៏មានសក្តានុពលដោយធ្វើអោយប្រសើរឡើងនូវមុខងារនៃការយល់ដឹងទូទៅ។

(៤) ការពារការបាត់បង់សាច់ដុំ
ការបាត់បង់សាច់ដុំអាចកើតឡើងដោយសារតែហេតុផលផ្សេងៗដូចជាភាពមិនប្រក្រតីភាពចាស់និងកង្វះប្រូតេអ៊ីននៅក្នុងរបបអាហារ។ វិធានការជាច្រើនដើម្បីបញ្ឈប់កំណត់ឬទប់ស្កាត់ការជ្រុះសាច់ដុំបានប្រសើរជាងមុនរួមមានការធ្វើលំហាត់ប្រាណថ្នាំនិងអាស៊ីតអាមីណូក៏ដូចជាប៉ូលីហ្វេណុលអាចប្រើបាន។

Urolithins អាចត្រូវបានចាត់ថ្នាក់ជាប៉ូលីហ្វេណុលនិងដើរតួក្នុងការការពារការបាត់បង់សាច់ដុំដោយធ្វើឱ្យសកម្មការសំយោគប្រូតេអ៊ីនសាច់ដុំនិងបន្ថយល្បឿននៃការចុះខ្សោយផងដែរ។

នៅក្នុងការសិក្សាជាមួយសត្វកណ្តុរថ្នាំបំប៉ន Urolithin B ដែលត្រូវបានគ្រប់គ្រងក្នុងរយៈពេលមួយត្រូវបានគេរកឃើញថាជួយបង្កើនការលូតលាស់សាច់ដុំរបស់ពួកគេនៅពេលដែលសាច់ដុំត្រូវបានគេមើលឃើញថាមានទំហំធំ។

(៥) យូរ៉ូលីទីនប្រយុទ្ធប្រឆាំងនឹងការរលាក
Urolithin B មានលក្ខណៈសម្បត្តិប្រឆាំងនឹងការរលាកដោយកាត់បន្ថយសញ្ញាសំគាល់រលាកភាគច្រើន។

នៅក្នុងការសិក្សាអំពីសត្វកណ្តុរដែលមានជំងឺតម្រងនោមដែលបណ្តាលអោយមាន urolithin B ត្រូវបានគេរកឃើញថាធ្វើអោយមានបញ្ហាតំរងនោម។ វាជួយពង្រឹងមុខងារតំរងនោម, លក្ខណៈវិទ្យានៃតំរងនោមក៏ដូចជាកាត់បន្ថយសញ្ញាសំគាល់របួសតំរងនោម។ នេះបង្ហាញថាយូប៊ីអាចកាត់បន្ថយការរលាកតម្រងនោម។

(៦) គុណប្រយោជន៍រួមនៃយូរ៉ូទីទីននិងខ
ផលប៉ះពាល់រួមត្រូវបានគេរាយការណ៍ផងដែរនៅក្នុងការរួមបញ្ចូលគ្នានៃ urolithin A និង B នៅក្នុងមុខងារនៃការយល់ដឹងនិងសមត្ថភាព។ ការសិក្សាបានបញ្ជាក់ថាការបញ្ចូលគ្នានេះអាចត្រូវបានប្រើក្នុងការព្យាបាលឬការពារជំងឺទាក់ទងនឹងជំងឺវង្វេងដូចជាការថប់បារម្ភឬជំងឺវង្វេងវង្វាន់។

អត្ថប្រយោជន៍ផ្សេងទៀតដែលទាក់ទងនឹង urolithins គឺ;

  • ទៅលើ
  • អាមីណូហ្សូស្យូមរោគសញ្ញារំលាយអាហារ


ប្រភពអាហារ Urolithin A និង B

Urolithins មិនត្រូវបានគេដឹងថាត្រូវបានរកឃើញដោយធម្មជាតិនៅក្នុងប្រភពចំណីអាហារណាមួយឡើយ។ ពួកវាគឺជាផលិតផលនៃការផ្លាស់ប្តូរអាស៊ីតអេលីហ្គិចដែលបានមកពីអេលីហ្គីននីន។ អេលហ្គេនទីននិនត្រូវបានផ្លាស់ប្តូរទៅជាអាស៊ីតអេលីហ្គិចដោយអតិសុខុមប្រាណហើយអាស៊ីតអេលីហ្គិកត្រូវបានបំលែងទៅជាមេតាប៉ូលីសរបស់វា (urolithins) នៅក្នុងពោះវៀនធំ។

Ellagitannins កើតឡើងដោយធម្មជាតិនៅក្នុងប្រភពចំណីអាហារដូចជាផ្លែទទឹមផ្លែប៊ឺរីរួមមានផ្លែស្ត្រប៊ឺរីរីរីរីសពពួកពពួកពពួកពពួកផ្លែទំពាំងបាយជូរផ្លែអាល់ម៉ុនផ្លែត្របែកតែនិងគ្រាប់ផ្លែឈើដូចជាគ្រាប់ Walnut និងគ្រាប់ផ្លែឈើ។ ធុងអូក។

ដូច្នេះយើងអាចសន្និដ្ឋានថាអាហារ urolithin A និងអាហារ urolithin B គឺជាអាហារដែលសំបូរទៅដោយ ellagitannin ។ វាគួរឱ្យកត់សម្គាល់ថាជីវឧស្ម័នជីវាណូលីនមានកម្រិតខ្លាំងណាស់ខណៈពេលដែលសារធាតុរំលាយអាហារបន្ទាប់បន្សំរបស់វាគឺមានជីវឧស្ម័នងាយស្រួល។

ការបញ្ចេញនិងផលិតកម្មយូរ៉ូទ្រីនខុសគ្នាយ៉ាងទូលំទូលាយក្នុងចំណោមបុគ្គលចាប់តាំងពីការផ្លាស់ប្តូរពី ellagitannins ពឹងផ្អែកលើមីក្រូជីតានៅក្នុងពោះវៀន។ មានបាក់តេរីជាក់លាក់ដែលពាក់ព័ន្ធនឹងការបំលែងទាំងនេះហើយខុសគ្នាក្នុងចំណោមបុគ្គលដែលអ្នកខ្លះមានអតិសុខុមប្រាណទាបខ្ពស់ឬមិនមាន។ ប្រភពចំណីអាហារក៏មានភាពខុសប្លែកគ្នានៅក្នុងកំរិតអេលីហ្គាទីននិនផងដែរ។ ដូច្នេះអត្ថប្រយោជន៍សក្តានុពលនៃ ellagitannins ប្រែប្រួលពីបុគ្គលម្នាក់ទៅមនុស្សម្នាក់ទៀត។


ថ្នាំបំប៉ន Urolithin A និង B

អាហារបំប៉ន Urolithin A ក៏ដូចជាថ្នាំបំប៉ន Urolithin B ត្រូវបានរកឃើញយ៉ាងងាយស្រួលនៅលើទីផ្សារជាថ្នាំគ្រាប់ប្រភពអាហារដែលសំបូរទៅដោយ ellagitannin ។ ថ្នាំបំប៉ន Urolithin A ក៏អាចរកបានផងដែរ។ អាហារបំប៉នផ្លែទទឹមភាគច្រើនត្រូវបានលក់និងប្រើប្រាស់យ៉ាងជោគជ័យ។ ថ្នាំគ្រាប់ទាំងនេះត្រូវបានសំយោគពីផ្លែឈើឬគ្រាប់ហើយបង្កើតជាទម្រង់រាវឬម្សៅ។

ដោយសារតែការប្រែប្រួលនៃកំហាប់ ellagitannins នៅក្នុងអាហារខុសគ្នាអតិថិជនរបស់ urolithin ទិញវាដោយពិចារណាលើប្រភពអាហារ។ អនុវត្តដូចគ្នានៅពេលរកប្រភពសម្រាប់ម្សៅ urolithin B ឬថ្នាំបំប៉នរាវ។

ការសិក្សាគ្លីនិករបស់មនុស្សពីរបីនាក់ដែលបានធ្វើឡើងជាមួយម្សៅ urolithin A ឬ B មិនបានរាយការណ៍ពីផលប៉ះពាល់ធ្ងន់ធ្ងរណាមួយពីការគ្រប់គ្រងថ្នាំគ្រាប់ទាំងនេះទេ។


  1. Garcia-Muñoz, គ្រីស្ទីណា; វ៉ាយឡង់, ហ្វាបរីស (២០១៤-១២-០២) ។ វាសនាមេតាប៉ូលីសរបស់អេឡាហ្គាទីននីន៖ ផលប៉ះពាល់ដល់សុខភាពនិងទស្សនៈស្រាវជ្រាវសម្រាប់អាហារមុខងារច្នៃប្រឌិត។ ការពិនិត្យឡើងវិញយ៉ាងសំខាន់នៅក្នុងវិទ្យាសាស្ត្រអាហារនិងអាហារូបត្ថម្ភ។
  2. Bialonska D, Kasimsetty SG, Khan SI, Ferreira D (ថ្ងៃទី ១១ ខែវិច្ឆិកាឆ្នាំ ២០០៩) ។ “ យូរ៉ូលីនទីនសារធាតុមេតាប៉ូលីសអតិសុខុមប្រាណក្នុងពោះវៀនរបស់ផ្លែទទឹមអ៊ីលឡាហ្គីតានិនបង្ហាញពីសកម្មភាពប្រឆាំងអុកស៊ីតកម្មដ៏ខ្លាំងក្លានៅក្នុងការធ្វើតេស្តផ្អែកលើកោសិកា” ។ ជេអាហ្គ្រីកអាហារគីមី។
  3. បូដវែល, ហ្គ្រាហាម; ប៉ូតធី, ​​អៀន; Nandaluru, Penchal (ឆ្នាំ ២០១១) ។ “ ការសំយោគសរុបដែលមានមូលដ្ឋានលើអេឡិចត្រុង-ឌីល-អាល់ឌឺ-សំយោគអ៊ូរ៉ូលីទីន M៧” ។