ម្សៅ Urolithin B ល្អបំផុត (១១៣៩-៨៣-៩) អ្នកផលិតនិងរោងចក្រ

ម្សៅ Urolithin B

ខែវិច្ឆិកា 9, 2020

យូរ៉ូទីលីនប៊ីអេសpecifications

ឈ្មោះ: យូរ៉ូទីលីនខ
ឈ្មោះគីមី: ៣- អ៊ីដ្រូអុកស៊ីដ -៦H-dibenzo [ខ, ឃ] pyran-៦- មួយ
CAS: 1139-83-9
រូបមន្តគីមី៖ C13H8O3
ទម្ងន់​ម៉ូលេគុល: 212.2 g / mol
color:  ម្សៅស
កូដអ៊ិនជី WXUQMTRHPNOXBV-UHFFFAOYSA-N
លេខកូដ SMILES៖ O=C1C2=CC=CC=C2C3=CC=C(O)C=C3O1
អនុគមន៍: Urolithin B អាចធ្វើអោយប្រសើរឡើងនូវមុខងារ mitochondrial និងសាច់ដុំ។

Urolithin B អាចធ្វើអោយប្រសើរឡើងនូវកម្លាំងសាច់ដុំនិងការស៊ូទ្រាំក្នុងវ័យចំណាស់។

កម្មវិធី: Urolithin B គឺជាសារធាតុរំលាយអាហារអតិសុខុមប្រាណនៅក្នុងពោះវៀននិងបង្ហាញនូវសកម្មភាពប្រឆាំងនឹងប្រតិកម្មអុកស៊ីតនិងប្រឆាំងអុកស៊ីតកម្មដ៏ខ្លាំងក្លាអាស្រ័យលើប្រព័ន្ធនិងលក្ខខណ្ឌ។ Urolithin B ក៏អាចបង្ហាញពីអរម៉ូនអ៊ឹស្ត្រូសែននិង / ឬសកម្មភាពប្រឆាំងនឹងអរម៉ូនអ៊ឹស្ត្រូសែន។
ភាពរលាយ: រលាយបានយ៉ាងងាយស្រួលនៅក្នុង N, N-dimethylformamide និង dimethylmethylene ។ ស៊ុលផូណុនរលាយបន្តិចក្នុងមេតាណុលអេតាណុលនិងអេទីលអេទីល
ឧបករណ៍ផ្ទុកទិន្នន័យ: Hygroscopic, -20 ° C ត្រជាក់, នៅក្រោមបរិយាកាស inert
លក្ខខណ្ឌដឹកជញ្ជូន៖ ដឹកតាមសីតុណ្ហភាពព័ទ្ធជុំវិញជាសារធាតុគីមីដែលមិនបង្កគ្រោះថ្នាក់។ ផលិតផលនេះមានស្ថេរភាពគ្រប់គ្រាន់សម្រាប់ពីរបីសប្តាហ៍ក្នុងកំឡុងពេលដឹកជញ្ជូនធម្មតានិងពេលវេលាដែលបានចំណាយនៅក្នុងគយ។