ម្សៅ Urolithin A

ខែវិច្ឆិកា 9, 2020

Cofttek គឺជាក្រុមហ៊ុនផលិតម្សៅ Urolithin A ល្អបំផុតនៅក្នុងប្រទេសចិន។ រោងចក្ររបស់យើងមានប្រព័ន្ធគ្រប់គ្រងផលិតកម្មពេញលេញ (អាយអេសអូ ៩០០១ និងអាយអេសអូ ១៤០០១) ដែលមានសមត្ថភាពផលិតបាន ៤០០ គីឡូក្រាមក្នុងមួយខែ។

 


ស្ថានភាព: នៅក្នុងផលិតកម្មអភិបូជា
អង្គភាព: ១ គីឡូក្រាម / កាបូប ២៥ គ។ ក្រ / ស្គរ

Urolithin ម្សៅជាក់លាក់

ឈ្មោះ: យូរ៉ូទីលីនក
ឈ្មោះគីមី: 3,8-Dihydroxybenzo [គ] chromen-6- មួយ
CAS: ៥១០​ ៩៨៦​ ៦៨៨០
រូបមន្តគីមី៖ C13H8O4
ទម្ងន់​ម៉ូលេគុល: 228.2
color: ម្សៅរឹងទៅជាពណ៌សទៅជាពណ៌ស
កូដអ៊ិនជី RIUPLDUFZCXCHM-UHFFFAOYSA-N
លេខកូដ SMILES៖ O=C1C2=CC(O)=CC=C2C3=C(O1)C=C(O)C=C3
អនុគមន៍: Urolithin A ដែលជាសារធាតុរំលាយអាហាររំលាយអាហារអតិសុខុមប្រាណនៃអាស៊ីត ellagic បញ្ចេញនូវមុខងារប្រឆាំងនឹងការរលាក, ប្រឆាំងនឹងប្រតិកម្មប្រឆាំងនិងប្រឆាំងអុកស៊ីតកម្ម។ Urolithin A បង្ករឱ្យមានជំងឺអូតូអ៊ុយមីននិង apoptosis ទប់ស្កាត់វដ្តកោសិកានិងរារាំងការសំយោគឌីអិនអេ។
កម្មវិធី: Urolithin A គឺជាសារធាតុរំលាយអាហារនៃ ellagitannin; អន្តរការីឱសថ
ភាពរលាយ: រលាយក្នុង DMSO (3 មីលីក្រាម / ម។ ល។ ) ។
ឧបករណ៍ផ្ទុកទិន្នន័យ: ស្ងួតស្រអាប់និងមានសីតុណ្ហភាព ០ - ៤ អង្សាសេក្នុងរយៈពេលខ្លី (ពីថ្ងៃទៅច្រើនសប្តាហ៍) ឬ -២០ អង្សាសេក្នុងរយៈពេលយូរ (ពីមួយឆ្នាំទៅមួយឆ្នាំ) ។
លក្ខខណ្ឌដឹកជញ្ជូន៖ ដឹកតាមសីតុណ្ហភាពព័ទ្ធជុំវិញជាសារធាតុគីមីដែលមិនបង្កគ្រោះថ្នាក់។ ផលិតផលនេះមានស្ថេរភាពគ្រប់គ្រាន់សម្រាប់ពីរបីសប្តាហ៍ក្នុងកំឡុងពេលដឹកជញ្ជូនធម្មតានិងពេលវេលាដែលបានចំណាយនៅក្នុងគយ។

 

យូរ៉ូទីលីនក អិនអឹមអេសស្ត្រូរ៉េម

យូរ៉ូលីទីន A (១១៤៣-៧០-០) - អិនអេមអរិយអរ

ប្រសិនបើអ្នកត្រូវការ COA, MSDS, HNMR សម្រាប់ផលិតផលនីមួយៗនិងព័ត៌មានផ្សេងៗសូមទាក់ទងមកយើងខ្ញុំ អ្នកគ្រប់គ្រង​ផ្នែក​ទីផ្សារ.

 

សេចក្តីផ្តើមអំពីយូរ៉ូលីន

Urolithins គឺជាសារធាតុរំលាយអាហារបន្ទាប់បន្សំនៃអាស៊ីត ellagic ដែលបានមកពី ellagitannins ។ នៅក្នុងខ្លួនមនុស្ស ellagitannins ត្រូវបានបំប្លែងដោយ microflora ពោះវៀនទៅជាអាស៊ីត ellagic ដែលត្រូវបានផ្លាស់ប្តូរទៅជា urolithins A, urolithin B, urolithin C និង urolithin D នៅក្នុងពោះវៀនធំ។

Urolithin A (UA) គឺជាសារធាតុរំលាយអាហារទូទៅបំផុតនៃ ellagitannins ។ ទោះយ៉ាងណាថ្នាំ urolithin A មិនត្រូវបានគេដឹងថាកើតឡើងដោយធម្មជាតិនៅក្នុងប្រភពនៃរបបអាហារណាមួយឡើយ។

Urolithin B (UB) គឺជាសារធាតុរំលាយអាហារមានច្រើនក្រៃលែងដែលផលិតនៅក្នុងពោះវៀនតាមរយៈការផ្លាស់ប្តូរ ellagitannins ។ Urolithin B គឺជាផលិតផលចុងក្រោយបន្ទាប់ពីគ្រប់ដេរីវេអ៊ុយរ៉ាលីទីនដទៃទៀតត្រូវបានបង្កើតឡើងដោយជាតិគីមី។ Urolithin B ត្រូវបានគេរកឃើញនៅក្នុងទឹកនោមដែលជា urolithin B glucuronide ។

Urolithin A 8-Methyl Ether គឺជាផលិតផលកម្រិតមធ្យមក្នុងកំឡុងពេលសំយោគ Urolithin A. វាជាសារធាតុរំលាយអាហារបន្ទាប់បន្សំដ៏សំខាន់នៃ ellagitannin និងមានសារធាតុប្រឆាំងអុកស៊ីតកម្មនិងប្រឆាំងនឹងការរលាក។

 

យន្តការនៃសកម្មភាពរបស់ urolithin A និង B

rol អ៊ុយរ៉ូទីន A បណ្តាលអោយមានបញ្ហាបំពង់រំលាយអាហារ

មីតូទីជីគឺជាទម្រង់មួយនៃអូតូអ៊ុយហ្គីដែលជួយលុបបំបាត់មីតូតូនិចដែលខូចសម្រាប់ដំណើរការល្អបំផុតរបស់ពួកគេ។ Autophagy សំដៅទៅលើដំណើរការទូទៅដែលខ្លឹមសារស៊ីតូទីកត្រូវបានបំផ្លាញហើយជាហេតុធ្វើឱ្យកែច្នៃឡើងវិញខណៈពេលដែលបំពង់រំលាយអាហារគឺជាការរិចរិលនិងការកែច្នៃឡើងវិញរបស់មីតូឈីនៀ។

អំឡុងពេលវ័យចំណាស់ការថយចុះនៃជំងឺអូតូអ៊ុយមីនគឺជាទិដ្ឋភាពមួយដែលនាំឱ្យមានការថយចុះមុខងារតូតូទីន។ លើសពីនេះទៀតភាពតានតឹងក្នុងអុកស៊ីតកម្មក៏អាចបណ្តាលឱ្យមានជំងឺអូតូអ៊ុយមីនទាប។ Urolithin A មានសមត្ថភាពក្នុងការលុបបំបាត់ mitochondria ដែលខូចខាតតាមរយៈអូតូអ៊ុយមីន។

properties លក្ខណៈសម្បត្តិប្រឆាំងអុកស៊ីតកម្ម

ភាពតានតឹងអុកស៊ីតកម្មកើតឡើងនៅពេលមានអតុល្យភាពរវាងរ៉ាឌីកាល់សេរីនិងអង់ទីអុកស៊ីដង់នៅក្នុងខ្លួន។ រ៉ាឌីកាល់សេរីលើសទាំងនេះច្រើនតែទាក់ទងនឹងជំងឺរ៉ាំរ៉ៃជាច្រើនដូចជាជំងឺបេះដូងទឹកនោមផ្អែមនិងមហារីក។

Urolithins A និង B បង្ហាញពីឥទ្ធិពលប្រឆាំងអុកស៊ីតកម្មតាមរយៈសមត្ថភាពរបស់ពួកគេក្នុងការកាត់បន្ថយរ៉ាឌីកាល់សេរីនិងជាពិសេសកម្រិតអុកស៊ីសែនប្រតិកម្ម (ROS) និងរារាំងការរំលាយជាតិខ្លាញ់ក្នុងប្រូតេអ៊ីនក្នុងប្រភេទកោសិកាមួយចំនួន។

លើសពីនេះទៀត urolithins អាចទប់ស្កាត់អង់ហ្ស៊ីមអុកស៊ីតកម្មមួយចំនួនរួមមានម៉ុនម៉ីនអុកស៊ីតូស៊ី A និង tyrosinase ។

properties លក្ខណៈសម្បត្តិប្រឆាំងនឹងការរលាក

ការរលាកគឺជាដំណើរការធម្មជាតិមួយដែលរាងកាយរបស់យើងប្រយុទ្ធប្រឆាំងនឹងវត្ថុដែលដួលរលំដូចជាការបង្ករោគការរងរបួសនិងអតិសុខុមប្រាណ។ ទោះជាយ៉ាងណាក៏ដោយការរលាករ៉ាំរ៉ៃអាចបង្កគ្រោះថ្នាក់ដល់រាងកាយដោយសារបញ្ហានេះត្រូវបានផ្សារភ្ជាប់ជាមួយនឹងជំងឺផ្សេងៗដូចជាជំងឺហឺតបញ្ហាបេះដូងនិងជំងឺមហារីក។ ការរលាករ៉ាំរ៉ៃអាចកើតឡើងដោយសារតែការរលាកស្រួចស្រាវដែលមិនត្រូវបានព្យាបាលការឆ្លងមេរោគឬសូម្បីតែរ៉ាឌីកាល់សេរីនៅក្នុងខ្លួន។

Urolithins A និង B បង្ហាញពីលក្ខណៈសម្បត្តិប្រឆាំងនឹងការរលាកដោយរារាំងការផលិតនីត្រាតអុកស៊ីត។ ពួកគេរារាំងជាពិសេសការបញ្ចេញប្រូតេអ៊ីននីត្រាតអុកស៊ីតអុកស៊ីត (iNOS) និងកន្សោម mRNA ដែលទទួលខុសត្រូវចំពោះការរលាក។

effects ផលប៉ះពាល់ប្រឆាំងនឹងអតិសុខុមប្រាណ

អតិសុខុមប្រាណរួមមានបាក់តេរីផ្សិតនិងវីរុសកើតឡើងដោយធម្មជាតិនៅក្នុងបរិស្ថាននិងក្នុងខ្លួនមនុស្ស។ ទោះយ៉ាងណាក៏ដោយអតិសុខុមប្រាណមួយចំនួនដែលសំដៅទៅលើភ្នាក់ងារបង្កជំងឺអាចបង្កឱ្យមានជំងឺឆ្លងដូចជាជំងឺផ្តាសាយកញ្ជ្រិលនិងជំងឺគ្រុនចាញ់។

Urolithin A និង B អាចបង្ហាញសកម្មភាពអង់ទីអុកស៊ីដ្យូមដោយរារាំងការចាប់អារម្មណ៍របស់កូរ៉ុម។ ការដឹងអំពីកូរ៉ុមគឺជារបៀបមួយនៃការប្រាស្រ័យទាក់ទងបាក់តេរីដែលជួយឱ្យបាក់តេរីអាចរកឃើញនិងគ្រប់គ្រងដំណើរការដែលទាក់ទងនឹងការឆ្លងដូចជាភាពរហ័សរហួននិងចលនា។

●ការហាមឃាត់គ្លីសេរីនប្រូតេអ៊ីន

គ្លីលីកសំដៅទៅលើការភ្ជាប់ជាតិស្ករដែលមិនមានអង់ស៊ីមទៅនឹងជាតិខ្លាញ់ឬប្រូតេអ៊ីន។ វាគឺជាជីវម៉ាសសំខាន់នៅក្នុងជំងឺទឹកនោមផ្អែមនិងជំងឺផ្សេងៗទៀតក៏ដូចជាភាពចាស់។

glycation ប្រូតេអ៊ីនខ្ពស់គឺជាឥទ្ធិពលបន្ទាប់បន្សំនៃ hyperglycemia មានតួនាទីសំខាន់ក្នុងជំងឺដែលទាក់ទងនឹងសរសៃឈាមបេះដូងដូចជាជំងឺទឹកនោមផ្អែមនិងជំងឺវង្វេងវង្វាន់។

Urolithin A និង B មានផ្ទុកនូវសារធាតុប្រឆាំងនឹងរោគ glycative ដែលអាស្រ័យទៅលើកំរិតដែលឯករាជ្យនៃសកម្មភាពប្រឆាំងអុកស៊ីតកម្មរបស់ពួកគេ។

 

អត្ថប្រយោជន័ Urolithin A

(១) អាចពន្យាអាយុជីវិត
Urolithin A បង្ករឱ្យមានបញ្ហាបំពង់រំលាយអាហារដោយការជ្រើសរើសយកមីតូសូដូរីដែលខូចខាត។ នេះក៏ធានានូវការកែច្នៃមីតូសូដូរីសម្រាប់ដំណើរការល្អបំផុតផងដែរ។ Mitochondria ច្រើនតែខូចខាតទៅតាមអាយុនិងដោយសារភាពតានតឹង។ ការកម្ចាត់មីតូសូដូរីដែលខូចខាតដើរតួនាទីក្នុងការពង្រីកអាយុកាល។

នៅក្នុងការសិក្សាអំពីពពួក Worm, urolithin ថ្នាំបំប៉នមួយត្រូវបានគ្រប់គ្រងនៅ ៥០ អ៉ីម៉ែតពីដំណាក់កាលស៊ុតរហូតដល់ការស្លាប់ត្រូវបានគេរកឃើញថាអាចពន្យារអាយុកាលរបស់ពួកគេបាន ៤៥,៤% ។

នៅក្នុងការសិក្សាមួយផ្សេងទៀតដែលបានធ្វើឡើងនៅឆ្នាំ ២០១៩ ដោយប្រើសរសៃឈាមមនុស្សវ័យចំណាស់, urolithin អាហារបំប៉នមួយត្រូវបានរកឃើញថាបង្ហាញពីសក្តានុពលប្រឆាំងភាពចាស់។ វាអាចបង្កើនកន្សោមកូឡាជែនប្រភេទទី ១ ហើយក៏អាចកាត់បន្ថយការបញ្ចេញមតិម៉ាទ្រីស metalloproteinase ១ ផងដែរ។

ការសិក្សារបស់មនុស្សតូចមួយក៏បានបង្ហាញផងដែរថាយូ។ អេ។ អេ។ អេ។ អាចធ្វើឱ្យប្រសើរឡើងនូវមុខងារផ្នែក mitochondrial និងសុខភាពគ្រោងឆ្អឹងចំពោះមនុស្សវ័យចំណាស់នៅពេលប្រើដោយផ្ទាល់មាត់ក្នុងកម្រិត ៥០០-១០០០mg ក្នុងរយៈពេល ៤ សប្តាហ៍។

(២) ជួយការពារជំងឺមហារីកក្រពេញប្រូស្តាត
សារធាតុ urolithins និងសារធាតុអេលហ្គីតានិនទីនមានសារធាតុប្រឆាំងនឹងជំងឺមហារីក។ ពួកគេអាចទប់ស្កាត់ការរីកសាយកោសិកាមហារីកតាមរយៈការចាប់ខ្លួនវដ្តកោសិកានិងជំរុញឱ្យមានជំងឺ apoptosis ។ Apoptosis សំដៅទៅលើការស្លាប់របស់កោសិកាដែលមានកម្មវិធីដែលរាងកាយអាចលុបបំបាត់កោសិកាមហារីកដែលមានសក្តានុពលនិងកោសិកាដែលមានមេរោគផ្សេងទៀត។

នៅក្នុងការសិក្សាអំពីសត្វកណ្តុរដែលបានចាក់បញ្ចូលទៅក្នុងកោសិកាមហារីករបស់មនុស្សអេទីលតានិននីនរំលាយអាហារ (យូរ៉ូទីន A) ត្រូវបានគេរកឃើញថាអាចទប់ស្កាត់ការលូតលាស់នៃជំងឺមហារីកក្រពេញប្រូស្តាត។ ការសិក្សានេះបានរាយការណ៍បន្ថែមទៀតថាការផ្តោតអារម្មណ៍ខ្ពស់នៃសារធាតុរំលាយអាហារនៅក្នុងក្រពេញប្រូស្តាតក្រពេញពោះវៀននិងជាលិកាពោះវៀន។

(៣) បង្កើនការយល់ដឹង
យូរ៉ូទីន A អាចការពារណឺរ៉ូនពីការស្លាប់ហើយក៏អាចបង្កឱ្យមានជម្ងឺប្រព័ន្ធប្រសាទតាមរយៈការផ្តល់សញ្ញាប្រឆាំងនឹងការរលាក។

នៅក្នុងការសិក្សាអំពីសត្វកណ្តុរដែលមានការចុះខ្សោយនៃការចងចាំយូរ៉ូទីន A ត្រូវបានគេរកឃើញថាមានការចុះខ្សោយនៃការយល់ដឹងនិងការពារណឺរ៉ូនពីជំងឺ apoptosis ។ នេះបង្ហាញថាអេឌីអាចត្រូវបានប្រើក្នុងការព្យាបាលជម្ងឺអាល់ហ្សៃមឺរ (អេឌី) ។

(៤) សក្តានុពលប្រឆាំងនឹងភាពធាត់
ការស្រាវជ្រាវបានបង្ហាញថា ellagitannins អាចទប់ស្កាត់ការប្រមូលផ្តុំជាតិខ្លាញ់ហើយក៏មានសញ្ញាសម្គាល់ adipogenic ដូចជាប្រូតេអ៊ីនឆ្លើយតបការលូតលាស់ដំបូង ២ ក៏ដូចជាប្រូតេអ៊ីនជួយពង្រឹងតាមរយៈការចាប់ខ្លួនវដ្តកោសិកា។

Urolithin A ត្រូវបានគេរកឃើញយ៉ាងពិសេសដើម្បីធ្វើឱ្យអាំងស៊ុយលីនមានភាពប្រសើរឡើងដូច្នេះការពារការវិវត្តនៃភាពធាត់។

នៅក្នុងការសិក្សាអំពីសត្វកណ្តុរដែលមានការធាត់ជម្រុញការធាត់ urolithin ត្រូវបានគេរកឃើញថាអាចការពារការធាត់ដែលបណ្តាលមកពីរបបអាហារនិងការចុះខ្សោយនៃមេតាប៉ូលីសនៅក្នុងសត្វកណ្តុរ។ ការសិក្សាបានបង្ហាញថាការព្យាបាលរបស់ UA បានបង្កើនការចំណាយថាមពលដូច្នេះម៉ាសរាងកាយទាប។

 

ប្រភពអាហារ Urolithin A និង B

Urolithins មិនត្រូវបានគេដឹងថាត្រូវបានរកឃើញដោយធម្មជាតិនៅក្នុងប្រភពចំណីអាហារណាមួយឡើយ។ ពួកវាគឺជាផលិតផលនៃការផ្លាស់ប្តូរអាស៊ីតអេលីហ្គិចដែលបានមកពីអេលីហ្គីននីន។ អេលហ្គេនទីននិនត្រូវបានផ្លាស់ប្តូរទៅជាអាស៊ីតអេលីហ្គិចដោយអតិសុខុមប្រាណហើយអាស៊ីតអេលីហ្គិកត្រូវបានបំលែងទៅជាមេតាប៉ូលីសរបស់វា (urolithins) នៅក្នុងពោះវៀនធំ។

Ellagitannins កើតឡើងដោយធម្មជាតិនៅក្នុងប្រភពចំណីអាហារដូចជាផ្លែទទឹមផ្លែប៊ឺរីរួមមានផ្លែស្ត្រប៊ឺរីរីរីរីសពពួកពពួកពពួកពពួកផ្លែទំពាំងបាយជូរផ្លែអាល់ម៉ុនផ្លែត្របែកតែនិងគ្រាប់ផ្លែឈើដូចជាគ្រាប់ Walnut និងគ្រាប់ផ្លែឈើ។ ធុងអូក។

ដូច្នេះយើងអាចសន្និដ្ឋានថាអាហារ urolithin A និងអាហារ urolithin B គឺជាអាហារដែលសំបូរទៅដោយ ellagitannin ។ វាគួរឱ្យកត់សម្គាល់ថាជីវឧស្ម័នជីវាណូលីនមានកម្រិតខ្លាំងណាស់ខណៈពេលដែលសារធាតុរំលាយអាហារបន្ទាប់បន្សំរបស់វាគឺមានជីវឧស្ម័នងាយស្រួល។

ការបញ្ចេញនិងផលិតកម្មយូរ៉ូទ្រីនខុសគ្នាយ៉ាងទូលំទូលាយក្នុងចំណោមបុគ្គលចាប់តាំងពីការផ្លាស់ប្តូរពី ellagitannins ពឹងផ្អែកលើមីក្រូជីតានៅក្នុងពោះវៀន។ មានបាក់តេរីជាក់លាក់ដែលពាក់ព័ន្ធនឹងការបំលែងទាំងនេះហើយខុសគ្នាក្នុងចំណោមបុគ្គលដែលអ្នកខ្លះមានអតិសុខុមប្រាណទាបខ្ពស់ឬមិនមាន។ ប្រភពចំណីអាហារក៏មានភាពខុសប្លែកគ្នានៅក្នុងកំរិតអេលីហ្គាទីននិនផងដែរ។ ដូច្នេះអត្ថប្រយោជន៍សក្តានុពលនៃ ellagitannins ប្រែប្រួលពីបុគ្គលម្នាក់ទៅមនុស្សម្នាក់ទៀត។

 

ថ្នាំបំប៉ន Urolithin A និង B

អាហារបំប៉ន Urolithin A ក៏ដូចជាថ្នាំបំប៉ន Urolithin B ត្រូវបានរកឃើញយ៉ាងងាយស្រួលនៅលើទីផ្សារជាថ្នាំគ្រាប់ប្រភពអាហារដែលសំបូរទៅដោយ ellagitannin ។ ថ្នាំបំប៉ន Urolithin A ក៏អាចរកបានផងដែរ។ អាហារបំប៉នផ្លែទទឹមភាគច្រើនត្រូវបានលក់និងប្រើប្រាស់យ៉ាងជោគជ័យ។ ថ្នាំគ្រាប់ទាំងនេះត្រូវបានសំយោគពីផ្លែឈើឬគ្រាប់ហើយបង្កើតជាទម្រង់រាវឬម្សៅ។

ដោយសារតែការប្រែប្រួលនៃកំហាប់ ellagitannins នៅក្នុងអាហារខុសគ្នាអតិថិជនរបស់ urolithin ទិញវាដោយពិចារណាលើប្រភពអាហារ។ អនុវត្តដូចគ្នានៅពេលរកប្រភពសម្រាប់ម្សៅ urolithin B ឬថ្នាំបំប៉នរាវ។

ការសិក្សាគ្លីនិករបស់មនុស្សពីរបីនាក់ដែលបានធ្វើឡើងជាមួយម្សៅ urolithin A ឬ B មិនបានរាយការណ៍ពីផលប៉ះពាល់ធ្ងន់ធ្ងរណាមួយពីការគ្រប់គ្រងថ្នាំគ្រាប់ទាំងនេះទេ។

ឯកសារយោង

  1. Garcia-Muñoz, គ្រីស្ទីណា; វ៉ាយឡង់, ហ្វាបរីស (២០១៤-១២-០២) ។ វាសនាមេតាប៉ូលីសរបស់អេឡាហ្គាទីននីន៖ ផលប៉ះពាល់ដល់សុខភាពនិងទស្សនៈស្រាវជ្រាវសម្រាប់អាហារមុខងារច្នៃប្រឌិត។ ការពិនិត្យឡើងវិញយ៉ាងសំខាន់នៅក្នុងវិទ្យាសាស្ត្រអាហារនិងអាហារូបត្ថម្ភ។
  2. Bialonska D, Kasimsetty SG, Khan SI, Ferreira D (ថ្ងៃទី ១១ ខែវិច្ឆិកាឆ្នាំ ២០០៩) ។ “ យូរ៉ូលីនទីនសារធាតុមេតាប៉ូលីសអតិសុខុមប្រាណក្នុងពោះវៀនរបស់ផ្លែទទឹមអ៊ីលឡាហ្គីតានិនបង្ហាញពីសកម្មភាពប្រឆាំងអុកស៊ីតកម្មដ៏ខ្លាំងក្លានៅក្នុងការធ្វើតេស្តផ្អែកលើកោសិកា” ។ ជេអាហ្គ្រីកអាហារគីមី។
  3. បូដវែល, ហ្គ្រាហាម; ប៉ូតធី, ​​អៀន; Nandaluru, Penchal (ឆ្នាំ ២០១១) ។ “ ការសំយោគសរុបដែលមានមូលដ្ឋានលើអេឡិចត្រុង-ឌីល-អាល់ឌឺ-សំយោគអ៊ូរ៉ូលីទីន M៧” ។